C29H32N2O4 — CID 162785717
tert-butyl 4-[2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-methyl-3-pyridinyl]butanoate (PubChem CID 162785717) has the molecular formula C29H32N2O4 and a molecular weight of 472.59 g/mol. Its IUPAC name is tert-butyl 4-[2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-methyl-3-pyridinyl]butanoate.
| Compound Name | tert-butyl 4-[2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-methyl-3-pyridinyl]butanoate |
|---|---|
| PubChem CID | 162785717 |
| Molecular Formula | C29H32N2O4 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | tert-butyl 4-[2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-methyl-3-pyridinyl]butanoate |
| SMILES | Cc1ccc(CCCC(=O)OC(C)(C)C)c(NC(=O)OCC2c3ccccc3-c3ccccc32)n1 |
| InChI | InChI=1S/C29H32N2O4/c1-19-16-17-20(10-9-15-26(32)35-29(2,3)4)27(30-19)31-28(33)34-18-25-23-13-7-5-11-21(23)22-12-6-8-14-24(22)25/h5-8,11-14,16-17,25H,9-10,15,18H2,1-4H3,(H,30,31,33) |
| InChIKey | PGBITNJHVRGUBL-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |