C25H22F3N3O2 — CID 170492845
9H-fluoren-9-ylmethyl N-[4-[6-amino-2-(trifluoromethyl)-3-pyridinyl]but-3-enyl]carbamate (PubChem CID 170492845) has the molecular formula C25H22F3N3O2 and a molecular weight of 453.46 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[4-[6-amino-2-(trifluoromethyl)-3-pyridinyl]but-3-enyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[4-[6-amino-2-(trifluoromethyl)-3-pyridinyl]but-3-enyl]carbamate |
|---|---|
| PubChem CID | 170492845 |
| Molecular Formula | C25H22F3N3O2 |
| Molecular Weight | 453.46 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[4-[6-amino-2-(trifluoromethyl)-3-pyridinyl]but-3-enyl]carbamate |
| SMILES | Nc1ccc(C=CCCNC(=O)OCC2c3ccccc3-c3ccccc32)c(C(F)(F)F)n1 |
| InChI | InChI=1S/C25H22F3N3O2/c26-25(27,28)23-16(12-13-22(29)31-23)7-5-6-14-30-24(32)33-15-21-19-10-3-1-8-17(19)18-9-2-4-11-20(18)21/h1-5,7-13,21H,6,14-15H2,(H2,29,31)(H,30,32) |
| InChIKey | VAYHEFIVVHDZPX-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.46 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|