C26H23F4N4O2- — CID 145395594
[5-(3-fluorophenyl)-3-[4-[[3-(trifluoromethyl)phenyl]methylcarbamoyloxy]butyl]-3H-pyrrolo[2,3-c]pyridin-7-yl]azanide (PubChem CID 145395594) has the molecular formula C26H23F4N4O2- and a molecular weight of 499.49 g/mol. Its IUPAC name is [5-(3-fluorophenyl)-3-[4-[[3-(trifluoromethyl)phenyl]methylcarbamoyloxy]butyl]-3H-pyrrolo[2,3-c]pyridin-7-yl]azanide.
| Compound Name | [5-(3-fluorophenyl)-3-[4-[[3-(trifluoromethyl)phenyl]methylcarbamoyloxy]butyl]-3H-pyrrolo[2,3-c]pyridin-7-yl]azanide |
|---|---|
| PubChem CID | 145395594 |
| Molecular Formula | C26H23F4N4O2- |
| Molecular Weight | 499.49 g/mol |
| Exact Mass | 499.18 |
| IUPAC Name | [5-(3-fluorophenyl)-3-[4-[[3-(trifluoromethyl)phenyl]methylcarbamoyloxy]butyl]-3H-pyrrolo[2,3-c]pyridin-7-yl]azanide |
| SMILES | [NH-]c1nc(-c2cccc(F)c2)cc2c1N=CC2CCCCOC(=O)NCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C26H24F4N4O2/c27-20-9-4-7-17(12-20)22-13-21-18(15-32-23(21)24(31)34-22)6-1-2-10-36-25(35)33-14-16-5-3-8-19(11-16)26(28,29)30/h3-5,7-9,11-13,15,18H,1-2,6,10,14H2,(H3,31,33,34,35)/p-1 |
| InChIKey | KQLLOQHHKBUWJI-UHFFFAOYSA-M |
| XLogP | 7.49 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.49 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|