C21H34O3Si — CID 162786827
(3R,7R)-3-[tert-butyl(dimethyl)silyl]oxy-7-[(3,3-dimethyloxiran-2-yl)methyl]-7-methyl-2,3-dihydro-1H-inden-4-one (PubChem CID 162786827) has the molecular formula C21H34O3Si and a molecular weight of 362.59 g/mol. Its IUPAC name is (3R,7R)-3-[tert-butyl(dimethyl)silyl]oxy-7-[(3,3-dimethyloxiran-2-yl)methyl]-7-methyl-2,3-dihydro-1H-inden-4-one.
| Compound Name | (3R,7R)-3-[tert-butyl(dimethyl)silyl]oxy-7-[(3,3-dimethyloxiran-2-yl)methyl]-7-methyl-2,3-dihydro-1H-inden-4-one |
|---|---|
| PubChem CID | 162786827 |
| Molecular Formula | C21H34O3Si |
| Molecular Weight | 362.59 g/mol |
| Exact Mass | 362.23 |
| IUPAC Name | (3R,7R)-3-[tert-butyl(dimethyl)silyl]oxy-7-[(3,3-dimethyloxiran-2-yl)methyl]-7-methyl-2,3-dihydro-1H-inden-4-one |
| SMILES | CC1(C)OC1C[C@]1(C)C=CC(=O)C2=C1CC[C@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H34O3Si/c1-19(2,3)25(7,8)24-16-10-9-14-18(16)15(22)11-12-21(14,6)13-17-20(4,5)23-17/h11-12,16-17H,9-10,13H2,1-8H3/t16-,17?,21+/m1/s1 |
| InChIKey | KXMZXPVFAWNNPC-PQLKOCLTSA-N |
| XLogP | 5.18 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.59 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|