C20H32O3Si — CID 162786783
(3R,7R)-3-[tert-butyl(dimethyl)silyl]oxy-7-methyl-7-[(3-methyloxiran-2-yl)methyl]-2,3-dihydro-1H-inden-4-one (PubChem CID 162786783) has the molecular formula C20H32O3Si and a molecular weight of 348.56 g/mol. Its IUPAC name is (3R,7R)-3-[tert-butyl(dimethyl)silyl]oxy-7-methyl-7-[(3-methyloxiran-2-yl)methyl]-2,3-dihydro-1H-inden-4-one.
| Compound Name | (3R,7R)-3-[tert-butyl(dimethyl)silyl]oxy-7-methyl-7-[(3-methyloxiran-2-yl)methyl]-2,3-dihydro-1H-inden-4-one |
|---|---|
| PubChem CID | 162786783 |
| Molecular Formula | C20H32O3Si |
| Molecular Weight | 348.56 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | (3R,7R)-3-[tert-butyl(dimethyl)silyl]oxy-7-methyl-7-[(3-methyloxiran-2-yl)methyl]-2,3-dihydro-1H-inden-4-one |
| SMILES | CC1OC1C[C@]1(C)C=CC(=O)C2=C1CC[C@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H32O3Si/c1-13-17(22-13)12-20(5)11-10-15(21)18-14(20)8-9-16(18)23-24(6,7)19(2,3)4/h10-11,13,16-17H,8-9,12H2,1-7H3/t13?,16-,17?,20+/m1/s1 |
| InChIKey | DICOPEXZVRSEJT-PMGSDFOBSA-N |
| XLogP | 4.79 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.56 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|