C26H44O3Si — CID 11407835
(3E,7E,11S,12R)-2-[tert-butyl(dimethyl)silyl]oxy-14-ethoxy-8,11,12-trimethylbicyclo[9.3.1]pentadeca-1(14),3,7-trien-15-one (PubChem CID 11407835) has the molecular formula C26H44O3Si and a molecular weight of 432.72 g/mol. Its IUPAC name is (3E,7E,11S,12R)-2-[tert-butyl(dimethyl)silyl]oxy-14-ethoxy-8,11,12-trimethylbicyclo[9.3.1]pentadeca-1(14),3,7-trien-15-one.
| Compound Name | (3E,7E,11S,12R)-2-[tert-butyl(dimethyl)silyl]oxy-14-ethoxy-8,11,12-trimethylbicyclo[9.3.1]pentadeca-1(14),3,7-trien-15-one |
|---|---|
| PubChem CID | 11407835 |
| Molecular Formula | C26H44O3Si |
| Molecular Weight | 432.72 g/mol |
| Exact Mass | 432.31 |
| IUPAC Name | (3E,7E,11S,12R)-2-[tert-butyl(dimethyl)silyl]oxy-14-ethoxy-8,11,12-trimethylbicyclo[9.3.1]pentadeca-1(14),3,7-trien-15-one |
| SMILES | CCOC1=C2C(=O)[C@@](C)(CC/C(C)=C/CC/C=C/C2O[Si](C)(C)C(C)(C)C)[C@H](C)C1 |
| InChI | InChI=1S/C26H44O3Si/c1-10-28-22-18-20(3)26(7)17-16-19(2)14-12-11-13-15-21(23(22)24(26)27)29-30(8,9)25(4,5)6/h13-15,20-21H,10-12,16-18H2,1-9H3/b15-13+,19-14+/t20-,21?,26+/m1/s1 |
| InChIKey | QEBRVXIMVQUNSR-OPANESSASA-N |
| XLogP | 7.36 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.72 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|