C22H34O3 — CID 11152197
(5R,6R)-3-ethoxy-2-(1-hydroxyprop-2-enyl)-5,6-dimethyl-6-[(3E)-3-methylocta-3,7-dienyl]cyclohex-2-en-1-one (PubChem CID 11152197) has the molecular formula C22H34O3 and a molecular weight of 346.51 g/mol. Its IUPAC name is (5R,6R)-3-ethoxy-2-(1-hydroxyprop-2-enyl)-5,6-dimethyl-6-[(3E)-3-methylocta-3,7-dienyl]cyclohex-2-en-1-one.
| Compound Name | (5R,6R)-3-ethoxy-2-(1-hydroxyprop-2-enyl)-5,6-dimethyl-6-[(3E)-3-methylocta-3,7-dienyl]cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 11152197 |
| Molecular Formula | C22H34O3 |
| Molecular Weight | 346.51 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | (5R,6R)-3-ethoxy-2-(1-hydroxyprop-2-enyl)-5,6-dimethyl-6-[(3E)-3-methylocta-3,7-dienyl]cyclohex-2-en-1-one |
| SMILES | C=CCC/C=C(\C)CC[C@@]1(C)C(=O)C(C(O)C=C)=C(OCC)C[C@H]1C |
| InChI | InChI=1S/C22H34O3/c1-7-10-11-12-16(4)13-14-22(6)17(5)15-19(25-9-3)20(21(22)24)18(23)8-2/h7-8,12,17-18,23H,1-2,9-11,13-15H2,3-6H3/b16-12+/t17-,18?,22-/m1/s1 |
| InChIKey | BUPLHGYQAAXCDZ-DZPFJMJVSA-N |
| XLogP | 5.13 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.51 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|