C24H40O6 — CID 11430191
methoxymethyl (2E,6E)-9-[(1R,4S,6R)-2-(hydroxymethyl)-4-(methoxymethoxy)-1,6-dimethylcyclohex-2-en-1-yl]-3,7-dimethylnona-2,6-dienoate (PubChem CID 11430191) has the molecular formula C24H40O6 and a molecular weight of 424.58 g/mol. Its IUPAC name is methoxymethyl (2E,6E)-9-[(1R,4S,6R)-2-(hydroxymethyl)-4-(methoxymethoxy)-1,6-dimethylcyclohex-2-en-1-yl]-3,7-dimethylnona-2,6-dienoate.
| Compound Name | methoxymethyl (2E,6E)-9-[(1R,4S,6R)-2-(hydroxymethyl)-4-(methoxymethoxy)-1,6-dimethylcyclohex-2-en-1-yl]-3,7-dimethylnona-2,6-dienoate |
|---|---|
| PubChem CID | 11430191 |
| Molecular Formula | C24H40O6 |
| Molecular Weight | 424.58 g/mol |
| Exact Mass | 424.28 |
| IUPAC Name | methoxymethyl (2E,6E)-9-[(1R,4S,6R)-2-(hydroxymethyl)-4-(methoxymethoxy)-1,6-dimethylcyclohex-2-en-1-yl]-3,7-dimethylnona-2,6-dienoate |
| SMILES | COCOC(=O)/C=C(\C)CC/C=C(\C)CC[C@@]1(C)C(CO)=C[C@@H](OCOC)C[C@H]1C |
| InChI | InChI=1S/C24H40O6/c1-18(8-7-9-19(2)12-23(26)30-17-28-6)10-11-24(4)20(3)13-22(29-16-27-5)14-21(24)15-25/h8,12,14,20,22,25H,7,9-11,13,15-17H2,1-6H3/b18-8+,19-12+/t20-,22+,24-/m1/s1 |
| InChIKey | WBEDBGMZFRISAJ-UMFFEWRUSA-N |
| XLogP | 4.54 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.58 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|