C19H28O3 — CID 11392548
(2E,6E)-9-[(1S,2R)-1,2-dimethyl-4,6-dioxocyclohexyl]-3,7-dimethylnona-2,6-dienal (PubChem CID 11392548) has the molecular formula C19H28O3 and a molecular weight of 304.43 g/mol. Its IUPAC name is (2E,6E)-9-[(1S,2R)-1,2-dimethyl-4,6-dioxocyclohexyl]-3,7-dimethylnona-2,6-dienal.
| Compound Name | (2E,6E)-9-[(1S,2R)-1,2-dimethyl-4,6-dioxocyclohexyl]-3,7-dimethylnona-2,6-dienal |
|---|---|
| PubChem CID | 11392548 |
| Molecular Formula | C19H28O3 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | (2E,6E)-9-[(1S,2R)-1,2-dimethyl-4,6-dioxocyclohexyl]-3,7-dimethylnona-2,6-dienal |
| SMILES | C/C(=C\C=O)CC/C=C(\C)CC[C@]1(C)C(=O)CC(=O)C[C@H]1C |
| InChI | InChI=1S/C19H28O3/c1-14(6-5-7-15(2)9-11-20)8-10-19(4)16(3)12-17(21)13-18(19)22/h6,9,11,16H,5,7-8,10,12-13H2,1-4H3/b14-6+,15-9+/t16-,19+/m1/s1 |
| InChIKey | JWTOUMJXZXQQJX-CEKVOJRHSA-N |
| XLogP | 4.21 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|