C28H48O3Si — CID 11259728
(5R,6R)-2-[1-[tert-butyl(dimethyl)silyl]oxyprop-2-enyl]-3-ethoxy-5,6-dimethyl-6-[(3E)-3-methylocta-3,7-dienyl]cyclohex-2-en-1-one (PubChem CID 11259728) has the molecular formula C28H48O3Si and a molecular weight of 460.78 g/mol. Its IUPAC name is (5R,6R)-2-[1-[tert-butyl(dimethyl)silyl]oxyprop-2-enyl]-3-ethoxy-5,6-dimethyl-6-[(3E)-3-methylocta-3,7-dienyl]cyclohex-2-en-1-one.
| Compound Name | (5R,6R)-2-[1-[tert-butyl(dimethyl)silyl]oxyprop-2-enyl]-3-ethoxy-5,6-dimethyl-6-[(3E)-3-methylocta-3,7-dienyl]cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 11259728 |
| Molecular Formula | C28H48O3Si |
| Molecular Weight | 460.78 g/mol |
| Exact Mass | 460.34 |
| IUPAC Name | (5R,6R)-2-[1-[tert-butyl(dimethyl)silyl]oxyprop-2-enyl]-3-ethoxy-5,6-dimethyl-6-[(3E)-3-methylocta-3,7-dienyl]cyclohex-2-en-1-one |
| SMILES | C=CCC/C=C(\C)CC[C@@]1(C)C(=O)C(C(C=C)O[Si](C)(C)C(C)(C)C)=C(OCC)C[C@H]1C |
| InChI | InChI=1S/C28H48O3Si/c1-12-15-16-17-21(4)18-19-28(9)22(5)20-24(30-14-3)25(26(28)29)23(13-2)31-32(10,11)27(6,7)8/h12-13,17,22-23H,1-2,14-16,18-20H2,3-11H3/b21-17+/t22-,23?,28-/m1/s1 |
| InChIKey | NURPTCORAHACJE-CALDYHEMSA-N |
| XLogP | 8.16 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.78 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|