C15H14FeN2O — CID 162787673
cyclopenta-1,3-diene;2-cyclopenta-1,3-dien-1-yl-6-methoxypyrazine;iron(2+) (PubChem CID 162787673) has the molecular formula C15H14FeN2O and a molecular weight of 294.14 g/mol. Its IUPAC name is cyclopenta-1,3-diene;2-cyclopenta-1,3-dien-1-yl-6-methoxypyrazine;iron(2+).
| Compound Name | cyclopenta-1,3-diene;2-cyclopenta-1,3-dien-1-yl-6-methoxypyrazine;iron(2+) |
|---|---|
| PubChem CID | 162787673 |
| Molecular Formula | C15H14FeN2O |
| Molecular Weight | 294.14 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | cyclopenta-1,3-diene;2-cyclopenta-1,3-dien-1-yl-6-methoxypyrazine;iron(2+) |
| SMILES | COc1cncc(-c2ccc[cH-]2)n1.[Fe+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C10H9N2O.C5H5.Fe/c1-13-10-7-11-6-9(12-10)8-4-2-3-5-8;1-2-4-5-3-1;/h2-7H,1H3;1-5H;/q2*-1;+2 |
| InChIKey | VXPHUFZLZOBCEO-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.14 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|