C14H13N5O — CID 95931444
2-methoxy-6-(5-methyl-1-phenyl-1,2,4-triazol-3-yl)pyrazine (PubChem CID 95931444) has the molecular formula C14H13N5O and a molecular weight of 267.29 g/mol. Its IUPAC name is 2-methoxy-6-(5-methyl-1-phenyl-1,2,4-triazol-3-yl)pyrazine.
| Compound Name | 2-methoxy-6-(5-methyl-1-phenyl-1,2,4-triazol-3-yl)pyrazine |
|---|---|
| PubChem CID | 95931444 |
| Molecular Formula | C14H13N5O |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 2-methoxy-6-(5-methyl-1-phenyl-1,2,4-triazol-3-yl)pyrazine |
| SMILES | COc1cncc(-c2nc(C)n(-c3ccccc3)n2)n1 |
| InChI | InChI=1S/C14H13N5O/c1-10-16-14(12-8-15-9-13(17-12)20-2)18-19(10)11-6-4-3-5-7-11/h3-9H,1-2H3 |
| InChIKey | ROOFMISNHOHVMJ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 65.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |