C30H18O9 — CID 162788197
5,9,21,24-tetrahydroxy-26-methylheptacyclo[15.12.0.01,21.03,16.06,15.08,13.023,28]nonacosa-3,5,8(13),9,11,15,18,23(28),24,26-decaene-7,14,20,22,29-pentone (PubChem CID 162788197) has the molecular formula C30H18O9 and a molecular weight of 522.47 g/mol. Its IUPAC name is 5,9,21,24-tetrahydroxy-26-methylheptacyclo[15.12.0.01,21.03,16.06,15.08,13.023,28]nonacosa-3,5,8(13),9,11,15,18,23(28),24,26-decaene-7,14,20,22,29-pentone.
| Compound Name | 5,9,21,24-tetrahydroxy-26-methylheptacyclo[15.12.0.01,21.03,16.06,15.08,13.023,28]nonacosa-3,5,8(13),9,11,15,18,23(28),24,26-decaene-7,14,20,22,29-pentone |
|---|---|
| PubChem CID | 162788197 |
| Molecular Formula | C30H18O9 |
| Molecular Weight | 522.47 g/mol |
| Exact Mass | 522.10 |
| IUPAC Name | 5,9,21,24-tetrahydroxy-26-methylheptacyclo[15.12.0.01,21.03,16.06,15.08,13.023,28]nonacosa-3,5,8(13),9,11,15,18,23(28),24,26-decaene-7,14,20,22,29-pentone |
| SMILES | Cc1cc(O)c2c(c1)C(=O)C13Cc4cc(O)c5c(c4C1C=CC(=O)C3(O)C2=O)C(=O)c1cccc(O)c1C5=O |
| InChI | InChI=1S/C30H18O9/c1-11-7-14-22(17(32)8-11)28(38)30(39)19(34)6-5-15-20-12(10-29(15,30)27(14)37)9-18(33)23-24(20)25(35)13-3-2-4-16(31)21(13)26(23)36/h2-9,15,31-33,39H,10H2,1H3 |
| InChIKey | SAMXOERPOHKPHJ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 166.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.47 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|