C32H26O9 — CID 162788186
9,20,30-trihydroxy-5,25-dimethoxy-27-methyl-22-oxaheptacyclo[15.13.0.01,21.03,16.06,15.08,13.024,29]triaconta-3,5,8(13),9,11,15,18,24(29),25,27-decaene-7,14,23-trione (PubChem CID 162788186) has the molecular formula C32H26O9 and a molecular weight of 554.55 g/mol. Its IUPAC name is 9,20,30-trihydroxy-5,25-dimethoxy-27-methyl-22-oxaheptacyclo[15.13.0.01,21.03,16.06,15.08,13.024,29]triaconta-3,5,8(13),9,11,15,18,24(29),25,27-decaene-7,14,23-trione.
| Compound Name | 9,20,30-trihydroxy-5,25-dimethoxy-27-methyl-22-oxaheptacyclo[15.13.0.01,21.03,16.06,15.08,13.024,29]triaconta-3,5,8(13),9,11,15,18,24(29),25,27-decaene-7,14,23-trione |
|---|---|
| PubChem CID | 162788186 |
| Molecular Formula | C32H26O9 |
| Molecular Weight | 554.55 g/mol |
| Exact Mass | 554.16 |
| IUPAC Name | 9,20,30-trihydroxy-5,25-dimethoxy-27-methyl-22-oxaheptacyclo[15.13.0.01,21.03,16.06,15.08,13.024,29]triaconta-3,5,8(13),9,11,15,18,24(29),25,27-decaene-7,14,23-trione |
| SMILES | COc1cc(C)cc2c1C(=O)OC1C(O)C=CC3c4c(cc(OC)c5c4C(=O)c4cccc(O)c4C5=O)CC31C2O |
| InChI | InChI=1S/C32H26O9/c1-13-9-16-24(20(10-13)39-2)31(38)41-30-19(34)8-7-17-22-14(12-32(17,30)29(16)37)11-21(40-3)25-26(22)27(35)15-5-4-6-18(33)23(15)28(25)36/h4-11,17,19,29-30,33-34,37H,12H2,1-3H3 |
| InChIKey | PTEKHLCNKCAXPH-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.55 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|