C6H5N3O — CID 162789178
pyrrolo[3,4-d][1,3]oxazin-5-amine (PubChem CID 162789178) has the molecular formula C6H5N3O and a molecular weight of 135.13 g/mol. Its IUPAC name is pyrrolo[3,4-d][1,3]oxazin-5-amine.
| Compound Name | pyrrolo[3,4-d][1,3]oxazin-5-amine |
|---|---|
| PubChem CID | 162789178 |
| Molecular Formula | C6H5N3O |
| Molecular Weight | 135.13 g/mol |
| Exact Mass | 135.04 |
| IUPAC Name | pyrrolo[3,4-d][1,3]oxazin-5-amine |
| SMILES | Nc1ncc2ncocc1-2 |
| InChI | InChI=1S/C6H5N3O/c7-6-4-2-10-3-9-5(4)1-8-6/h1-3H,(H2,7,8) |
| InChIKey | WVESGQWYNOCRMB-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.13 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |