C10H7N3OS — CID 119089210
2-(1,3-oxazol-4-yl)thieno[3,2-c]pyridin-4-amine (PubChem CID 119089210) has the molecular formula C10H7N3OS and a molecular weight of 217.25 g/mol. Its IUPAC name is 2-(1,3-oxazol-4-yl)thieno[3,2-c]pyridin-4-amine.
| Compound Name | 2-(1,3-oxazol-4-yl)thieno[3,2-c]pyridin-4-amine |
|---|---|
| PubChem CID | 119089210 |
| Molecular Formula | C10H7N3OS |
| Molecular Weight | 217.25 g/mol |
| Exact Mass | 217.03 |
| IUPAC Name | 2-(1,3-oxazol-4-yl)thieno[3,2-c]pyridin-4-amine |
| SMILES | Nc1nccc2sc(-c3cocn3)cc12 |
| InChI | InChI=1S/C10H7N3OS/c11-10-6-3-9(7-4-14-5-13-7)15-8(6)1-2-12-10/h1-5H,(H2,11,12) |
| InChIKey | AWMOGKYPPJMTNY-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.25 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |