C11H6Cl2N4S — CID 171660023
5-chloro-4-(4-chlorothieno[3,2-c]pyridin-2-yl)pyrimidin-2-amine (PubChem CID 171660023) has the molecular formula C11H6Cl2N4S and a molecular weight of 297.17 g/mol. Its IUPAC name is 5-chloro-4-(4-chlorothieno[3,2-c]pyridin-2-yl)pyrimidin-2-amine.
| Compound Name | 5-chloro-4-(4-chlorothieno[3,2-c]pyridin-2-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 171660023 |
| Molecular Formula | C11H6Cl2N4S |
| Molecular Weight | 297.17 g/mol |
| Exact Mass | 295.97 |
| IUPAC Name | 5-chloro-4-(4-chlorothieno[3,2-c]pyridin-2-yl)pyrimidin-2-amine |
| SMILES | Nc1ncc(Cl)c(-c2cc3c(Cl)nccc3s2)n1 |
| InChI | InChI=1S/C11H6Cl2N4S/c12-6-4-16-11(14)17-9(6)8-3-5-7(18-8)1-2-15-10(5)13/h1-4H,(H2,14,16,17) |
| InChIKey | JXFBWSNPWZYYOE-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.17 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|