C14H10ClFN4 — CID 171660570
5-chloro-4-(8-fluoro-4-methylquinolin-6-yl)pyrimidin-2-amine (PubChem CID 171660570) has the molecular formula C14H10ClFN4 and a molecular weight of 288.71 g/mol. Its IUPAC name is 5-chloro-4-(8-fluoro-4-methylquinolin-6-yl)pyrimidin-2-amine.
| Compound Name | 5-chloro-4-(8-fluoro-4-methylquinolin-6-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 171660570 |
| Molecular Formula | C14H10ClFN4 |
| Molecular Weight | 288.71 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | 5-chloro-4-(8-fluoro-4-methylquinolin-6-yl)pyrimidin-2-amine |
| SMILES | Cc1ccnc2c(F)cc(-c3nc(N)ncc3Cl)cc12 |
| InChI | InChI=1S/C14H10ClFN4/c1-7-2-3-18-13-9(7)4-8(5-11(13)16)12-10(15)6-19-14(17)20-12/h2-6H,1H3,(H2,17,19,20) |
| InChIKey | CYAXQQPJVBFRQT-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.71 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |