C10H13N3 — CID 20680867
2-propan-2-yl-1H-pyrrolo[3,2-c]pyridin-4-amine (PubChem CID 20680867) has the molecular formula C10H13N3 and a molecular weight of 175.23 g/mol. Its IUPAC name is 2-propan-2-yl-1H-pyrrolo[3,2-c]pyridin-4-amine.
| Compound Name | 2-propan-2-yl-1H-pyrrolo[3,2-c]pyridin-4-amine |
|---|---|
| PubChem CID | 20680867 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | 2-propan-2-yl-1H-pyrrolo[3,2-c]pyridin-4-amine |
| SMILES | CC(C)c1cc2c(N)nccc2[nH]1 |
| InChI | InChI=1S/C10H13N3/c1-6(2)9-5-7-8(13-9)3-4-12-10(7)11/h3-6,13H,1-2H3,(H2,11,12) |
| InChIKey | VGGIRWQEVWVJOK-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |