C20H22O6 — CID 162790259
[(1R,2Z,4R,6S,9R,10R)-3-methyl-7,11-dimethylidene-12-oxo-13-oxatricyclo[8.3.0.04,6]tridec-2-en-9-yl] (5R)-5-hydroxy-2,5-dihydrofuran-3-carboxylate (PubChem CID 162790259) has the molecular formula C20H22O6 and a molecular weight of 358.39 g/mol. Its IUPAC name is [(1R,2Z,4R,6S,9R,10R)-3-methyl-7,11-dimethylidene-12-oxo-13-oxatricyclo[8.3.0.04,6]tridec-2-en-9-yl] (5R)-5-hydroxy-2,5-dihydrofuran-3-carboxylate.
| Compound Name | [(1R,2Z,4R,6S,9R,10R)-3-methyl-7,11-dimethylidene-12-oxo-13-oxatricyclo[8.3.0.04,6]tridec-2-en-9-yl] (5R)-5-hydroxy-2,5-dihydrofuran-3-carboxylate |
|---|---|
| PubChem CID | 162790259 |
| Molecular Formula | C20H22O6 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | [(1R,2Z,4R,6S,9R,10R)-3-methyl-7,11-dimethylidene-12-oxo-13-oxatricyclo[8.3.0.04,6]tridec-2-en-9-yl] (5R)-5-hydroxy-2,5-dihydrofuran-3-carboxylate |
| SMILES | C=C1C(=O)O[C@@H]2/C=C(/C)[C@@H]3C[C@@H]3C(=C)C[C@@H](OC(=O)C3=C[C@H](O)OC3)[C@@H]12 |
| InChI | InChI=1S/C20H22O6/c1-9-4-15-18(11(3)19(22)25-15)16(5-10(2)14-7-13(9)14)26-20(23)12-6-17(21)24-8-12/h4,6,13-18,21H,2-3,5,7-8H2,1H3/b9-4-/t13-,14+,15+,16+,17+,18-/m0/s1 |
| InChIKey | LLSFCQJEAXYIHK-ABIRJEGLSA-N |
| XLogP | 1.81 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|