C19H25N3O6 — CID 162793500
2-[(3R)-3-hydroxy-3-[(2R)-2-(2-hydroxypropan-2-yl)-4-methoxy-5-oxo-2,3-dihydrofuro[3,2-g]chromen-7-yl]propyl]guanidine (PubChem CID 162793500) has the molecular formula C19H25N3O6 and a molecular weight of 391.42 g/mol. Its IUPAC name is 2-[(3R)-3-hydroxy-3-[(2R)-2-(2-hydroxypropan-2-yl)-4-methoxy-5-oxo-2,3-dihydrofuro[3,2-g]chromen-7-yl]propyl]guanidine.
| Compound Name | 2-[(3R)-3-hydroxy-3-[(2R)-2-(2-hydroxypropan-2-yl)-4-methoxy-5-oxo-2,3-dihydrofuro[3,2-g]chromen-7-yl]propyl]guanidine |
|---|---|
| PubChem CID | 162793500 |
| Molecular Formula | C19H25N3O6 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | 2-[(3R)-3-hydroxy-3-[(2R)-2-(2-hydroxypropan-2-yl)-4-methoxy-5-oxo-2,3-dihydrofuro[3,2-g]chromen-7-yl]propyl]guanidine |
| SMILES | COc1c2c(cc3oc([C@H](O)CCN=C(N)N)cc(=O)c13)O[C@@H](C(C)(C)O)C2 |
| InChI | InChI=1S/C19H25N3O6/c1-19(2,25)15-6-9-12(28-15)8-14-16(17(9)26-3)11(24)7-13(27-14)10(23)4-5-22-18(20)21/h7-8,10,15,23,25H,4-6H2,1-3H3,(H4,20,21,22)/t10-,15-/m1/s1 |
| InChIKey | ROQYMKZRAFQPBX-MEBBXXQBSA-N |
| XLogP | 0.57 |
| TPSA | 153.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|