C22H30O11 — CID 163027014
4-methoxy-7-methyl-2-[2-(2,3,4,5,6-pentahydroxyhexylperoxy)propan-2-yl]-2,3-dihydrofuro[3,2-g]chromen-5-one (PubChem CID 163027014) has the molecular formula C22H30O11 and a molecular weight of 470.47 g/mol. Its IUPAC name is 4-methoxy-7-methyl-2-[2-(2,3,4,5,6-pentahydroxyhexylperoxy)propan-2-yl]-2,3-dihydrofuro[3,2-g]chromen-5-one.
| Compound Name | 4-methoxy-7-methyl-2-[2-(2,3,4,5,6-pentahydroxyhexylperoxy)propan-2-yl]-2,3-dihydrofuro[3,2-g]chromen-5-one |
|---|---|
| PubChem CID | 163027014 |
| Molecular Formula | C22H30O11 |
| Molecular Weight | 470.47 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | 4-methoxy-7-methyl-2-[2-(2,3,4,5,6-pentahydroxyhexylperoxy)propan-2-yl]-2,3-dihydrofuro[3,2-g]chromen-5-one |
| SMILES | COc1c2c(cc3oc(C)cc(=O)c13)OC(C(C)(C)OOCC(O)C(O)C(O)C(O)CO)C2 |
| InChI | InChI=1S/C22H30O11/c1-10-5-12(24)18-16(31-10)7-15-11(21(18)29-4)6-17(32-15)22(2,3)33-30-9-14(26)20(28)19(27)13(25)8-23/h5,7,13-14,17,19-20,23,25-28H,6,8-9H2,1-4H3 |
| InChIKey | GITWUAKLVOCHPE-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 168.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.47 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|