C28H37NO11 — CID 162828340
4-[8-methyl-6-oxo-3-(2,3,4,5,6-pentahydroxyhexylperoxy)spiro[3,4-dihydropyrano[3,2-g]chromene-2,3'-cyclohexane]-1'-yl]pyrrolidin-2-one (PubChem CID 162828340) has the molecular formula C28H37NO11 and a molecular weight of 563.60 g/mol. Its IUPAC name is 4-[8-methyl-6-oxo-3-(2,3,4,5,6-pentahydroxyhexylperoxy)spiro[3,4-dihydropyrano[3,2-g]chromene-2,3'-cyclohexane]-1'-yl]pyrrolidin-2-one.
| Compound Name | 4-[8-methyl-6-oxo-3-(2,3,4,5,6-pentahydroxyhexylperoxy)spiro[3,4-dihydropyrano[3,2-g]chromene-2,3'-cyclohexane]-1'-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 162828340 |
| Molecular Formula | C28H37NO11 |
| Molecular Weight | 563.60 g/mol |
| Exact Mass | 563.24 |
| IUPAC Name | 4-[8-methyl-6-oxo-3-(2,3,4,5,6-pentahydroxyhexylperoxy)spiro[3,4-dihydropyrano[3,2-g]chromene-2,3'-cyclohexane]-1'-yl]pyrrolidin-2-one |
| SMILES | Cc1cc(=O)c2cc3c(cc2o1)OC1(CCCC(C2CNC(=O)C2)C1)C(OOCC(O)C(O)C(O)C(O)CO)C3 |
| InChI | InChI=1S/C28H37NO11/c1-14-5-19(31)18-6-16-7-24(40-37-13-21(33)27(36)26(35)20(32)12-30)28(39-22(16)9-23(18)38-14)4-2-3-15(10-28)17-8-25(34)29-11-17/h5-6,9,15,17,20-21,24,26-27,30,32-33,35-36H,2-4,7-8,10-13H2,1H3,(H,29,34) |
| InChIKey | IAOMINMMRWOFOH-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 188.15 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.60 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|