C28H34N2O10 — CID 163160270
(3R)-2,2,8-trimethyl-3-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxy-3-(2H-pyrrolo[3,2-b]pyrrol-1-ylmethyl)hexyl]peroxy-3,4-dihydropyrano[3,2-g]chromen-6-one (PubChem CID 163160270) has the molecular formula C28H34N2O10 and a molecular weight of 558.58 g/mol. Its IUPAC name is (3R)-2,2,8-trimethyl-3-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxy-3-(2H-pyrrolo[3,2-b]pyrrol-1-ylmethyl)hexyl]peroxy-3,4-dihydropyrano[3,2-g]chromen-6-one.
| Compound Name | (3R)-2,2,8-trimethyl-3-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxy-3-(2H-pyrrolo[3,2-b]pyrrol-1-ylmethyl)hexyl]peroxy-3,4-dihydropyrano[3,2-g]chromen-6-one |
|---|---|
| PubChem CID | 163160270 |
| Molecular Formula | C28H34N2O10 |
| Molecular Weight | 558.58 g/mol |
| Exact Mass | 558.22 |
| IUPAC Name | (3R)-2,2,8-trimethyl-3-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxy-3-(2H-pyrrolo[3,2-b]pyrrol-1-ylmethyl)hexyl]peroxy-3,4-dihydropyrano[3,2-g]chromen-6-one |
| SMILES | Cc1cc(=O)c2cc3c(cc2o1)OC(C)(C)[C@H](OOC[C@H](O)[C@](O)(CN1CC=C2N=CC=C21)[C@H](O)[C@H](O)CO)C3 |
| InChI | InChI=1S/C28H34N2O10/c1-15-8-20(32)17-9-16-10-25(27(2,3)39-22(16)11-23(17)38-15)40-37-13-24(34)28(36,26(35)21(33)12-31)14-30-7-5-18-19(30)4-6-29-18/h4-6,8-9,11,21,24-26,31,33-36H,7,10,12-14H2,1-3H3/t21-,24+,25-,26-,28-/m1/s1 |
| InChIKey | QSHYLBNHZGEFLP-DBXCSHQOSA-N |
| XLogP | 0.11 |
| TPSA | 174.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.58 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|