C29H36N2O10 — CID 163172015
(3R)-10-(4-ethyl-6H-pyrrolo[2,3-c]pyrrol-5-yl)-2,2,8-trimethyl-3-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]peroxy-3,4-dihydropyrano[3,2-g]chromen-6-one (PubChem CID 163172015) has the molecular formula C29H36N2O10 and a molecular weight of 572.61 g/mol. Its IUPAC name is (3R)-10-(4-ethyl-6H-pyrrolo[2,3-c]pyrrol-5-yl)-2,2,8-trimethyl-3-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]peroxy-3,4-dihydropyrano[3,2-g]chromen-6-one.
| Compound Name | (3R)-10-(4-ethyl-6H-pyrrolo[2,3-c]pyrrol-5-yl)-2,2,8-trimethyl-3-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]peroxy-3,4-dihydropyrano[3,2-g]chromen-6-one |
|---|---|
| PubChem CID | 163172015 |
| Molecular Formula | C29H36N2O10 |
| Molecular Weight | 572.61 g/mol |
| Exact Mass | 572.24 |
| IUPAC Name | (3R)-10-(4-ethyl-6H-pyrrolo[2,3-c]pyrrol-5-yl)-2,2,8-trimethyl-3-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]peroxy-3,4-dihydropyrano[3,2-g]chromen-6-one |
| SMILES | CCC1=C2C=CN=C2CN1c1c2c(cc3c(=O)cc(C)oc13)C[C@@H](OOC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)C(C)(C)O2 |
| InChI | InChI=1S/C29H36N2O10/c1-5-19-16-6-7-30-18(16)11-31(19)24-27-15(9-17-20(33)8-14(2)39-28(17)24)10-23(29(3,4)40-27)41-38-13-22(35)26(37)25(36)21(34)12-32/h6-9,21-23,25-26,32,34-37H,5,10-13H2,1-4H3/t21-,22+,23-,25-,26-/m1/s1 |
| InChIKey | VSYHRSJDBOSBSD-KBDPUJGOSA-N |
| XLogP | 1.02 |
| TPSA | 174.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.61 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|