C29H38N3O10+ — CID 163170932
10-(5,6-dihydropyrrolo[3,4-b]pyrrol-5-ium-5-yl)-2,8-dimethyl-2-[2-(methylamino)ethyl]-3-(2,3,4,5,6-pentahydroxyhexylperoxy)-3,4-dihydropyrano[3,2-g]chromen-6-one (PubChem CID 163170932) has the molecular formula C29H38N3O10+ and a molecular weight of 588.63 g/mol. Its IUPAC name is 10-(5,6-dihydropyrrolo[3,4-b]pyrrol-5-ium-5-yl)-2,8-dimethyl-2-[2-(methylamino)ethyl]-3-(2,3,4,5,6-pentahydroxyhexylperoxy)-3,4-dihydropyrano[3,2-g]chromen-6-one.
| Compound Name | 10-(5,6-dihydropyrrolo[3,4-b]pyrrol-5-ium-5-yl)-2,8-dimethyl-2-[2-(methylamino)ethyl]-3-(2,3,4,5,6-pentahydroxyhexylperoxy)-3,4-dihydropyrano[3,2-g]chromen-6-one |
|---|---|
| PubChem CID | 163170932 |
| Molecular Formula | C29H38N3O10+ |
| Molecular Weight | 588.63 g/mol |
| Exact Mass | 588.26 |
| IUPAC Name | 10-(5,6-dihydropyrrolo[3,4-b]pyrrol-5-ium-5-yl)-2,8-dimethyl-2-[2-(methylamino)ethyl]-3-(2,3,4,5,6-pentahydroxyhexylperoxy)-3,4-dihydropyrano[3,2-g]chromen-6-one |
| SMILES | CNCCC1(C)Oc2c(cc3c(=O)cc(C)oc3c2[NH+]2C=C3C=CN=C3C2)CC1OOCC(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C29H37N3O10/c1-15-8-20(34)18-9-17-10-23(42-39-14-22(36)26(38)25(37)21(35)13-33)29(2,5-7-30-3)41-27(17)24(28(18)40-15)32-11-16-4-6-31-19(16)12-32/h4,6,8-9,11,21-23,25-26,30,33,35-38H,5,7,10,12-14H2,1-3H3/p+1 |
| InChIKey | VIUWMLICFIREQK-UHFFFAOYSA-O |
| XLogP | -1.46 |
| TPSA | 187.88 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.63 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|