C28H39NO12 — CID 162803887
4-[2-[10-(2-hydroxyethyl)-2,8-dimethyl-6-oxo-3-(2,3,4,5,6-pentahydroxyhexylperoxy)-3,4-dihydropyrano[3,2-g]chromen-2-yl]ethyl]pyrrolidin-2-one (PubChem CID 162803887) has the molecular formula C28H39NO12 and a molecular weight of 581.62 g/mol. Its IUPAC name is 4-[2-[10-(2-hydroxyethyl)-2,8-dimethyl-6-oxo-3-(2,3,4,5,6-pentahydroxyhexylperoxy)-3,4-dihydropyrano[3,2-g]chromen-2-yl]ethyl]pyrrolidin-2-one.
| Compound Name | 4-[2-[10-(2-hydroxyethyl)-2,8-dimethyl-6-oxo-3-(2,3,4,5,6-pentahydroxyhexylperoxy)-3,4-dihydropyrano[3,2-g]chromen-2-yl]ethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 162803887 |
| Molecular Formula | C28H39NO12 |
| Molecular Weight | 581.62 g/mol |
| Exact Mass | 581.25 |
| IUPAC Name | 4-[2-[10-(2-hydroxyethyl)-2,8-dimethyl-6-oxo-3-(2,3,4,5,6-pentahydroxyhexylperoxy)-3,4-dihydropyrano[3,2-g]chromen-2-yl]ethyl]pyrrolidin-2-one |
| SMILES | Cc1cc(=O)c2cc3c(c(CCO)c2o1)OC(C)(CCC1CNC(=O)C1)C(OOCC(O)C(O)C(O)C(O)CO)C3 |
| InChI | InChI=1S/C28H39NO12/c1-14-7-19(32)18-9-16-10-22(41-38-13-21(34)25(37)24(36)20(33)12-31)28(2,5-3-15-8-23(35)29-11-15)40-26(16)17(4-6-30)27(18)39-14/h7,9,15,20-22,24-25,30-31,33-34,36-37H,3-6,8,10-13H2,1-2H3,(H,29,35) |
| InChIKey | WOEQMRSLICJYFM-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 208.38 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.62 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|