C34H41N3O11 — CID 163177509
4-[8-methyl-6-oxo-3-(2,3,4,5,6-pentahydroxyhexylperoxy)-10-(6H-pyrrolo[3,4-b]pyrrol-5-yl)spiro[3,4-dihydropyrano[3,2-g]chromene-2,3'-cyclohexane]-1'-yl]pyrrolidin-2-one (PubChem CID 163177509) has the molecular formula C34H41N3O11 and a molecular weight of 667.71 g/mol. Its IUPAC name is 4-[8-methyl-6-oxo-3-(2,3,4,5,6-pentahydroxyhexylperoxy)-10-(6H-pyrrolo[3,4-b]pyrrol-5-yl)spiro[3,4-dihydropyrano[3,2-g]chromene-2,3'-cyclohexane]-1'-yl]pyrrolidin-2-one.
| Compound Name | 4-[8-methyl-6-oxo-3-(2,3,4,5,6-pentahydroxyhexylperoxy)-10-(6H-pyrrolo[3,4-b]pyrrol-5-yl)spiro[3,4-dihydropyrano[3,2-g]chromene-2,3'-cyclohexane]-1'-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 163177509 |
| Molecular Formula | C34H41N3O11 |
| Molecular Weight | 667.71 g/mol |
| Exact Mass | 667.27 |
| IUPAC Name | 4-[8-methyl-6-oxo-3-(2,3,4,5,6-pentahydroxyhexylperoxy)-10-(6H-pyrrolo[3,4-b]pyrrol-5-yl)spiro[3,4-dihydropyrano[3,2-g]chromene-2,3'-cyclohexane]-1'-yl]pyrrolidin-2-one |
| SMILES | Cc1cc(=O)c2cc3c(c(N4C=C5C=CN=C5C4)c2o1)OC1(CCCC(C2CNC(=O)C2)C1)C(OOCC(O)C(O)C(O)C(O)CO)C3 |
| InChI | InChI=1S/C34H41N3O11/c1-17-7-24(39)22-8-20-9-27(48-45-16-26(41)31(44)30(43)25(40)15-38)34(5-2-3-18(11-34)21-10-28(42)36-12-21)47-32(20)29(33(22)46-17)37-13-19-4-6-35-23(19)14-37/h4,6-8,13,18,21,25-27,30-31,38,40-41,43-44H,2-3,5,9-12,14-16H2,1H3,(H,36,42) |
| InChIKey | XVSXKRHUVWZRNO-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 203.75 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.71 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|