C29H36N2O10 — CID 162794287
(2S,3S,4S,5S,6S)-3,4,5-trihydroxy-6-[3-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxy-5-[[[(3S)-3-methyl-5-(methylamino)pentyl]amino]methyl]oxane-2-carboxylic acid (PubChem CID 162794287) has the molecular formula C29H36N2O10 and a molecular weight of 572.61 g/mol. Its IUPAC name is (2S,3S,4S,5S,6S)-3,4,5-trihydroxy-6-[3-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxy-5-[[[(3S)-3-methyl-5-(methylamino)pentyl]amino]methyl]oxane-2-carboxylic acid.
| Compound Name | (2S,3S,4S,5S,6S)-3,4,5-trihydroxy-6-[3-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxy-5-[[[(3S)-3-methyl-5-(methylamino)pentyl]amino]methyl]oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 162794287 |
| Molecular Formula | C29H36N2O10 |
| Molecular Weight | 572.61 g/mol |
| Exact Mass | 572.24 |
| IUPAC Name | (2S,3S,4S,5S,6S)-3,4,5-trihydroxy-6-[3-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxy-5-[[[(3S)-3-methyl-5-(methylamino)pentyl]amino]methyl]oxane-2-carboxylic acid |
| SMILES | CNCC[C@H](C)CCNC[C@@]1(O)[C@H](Oc2ccc3c(=O)c(-c4ccc(O)cc4)coc3c2)O[C@H](C(=O)O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C29H36N2O10/c1-16(9-11-30-2)10-12-31-15-29(38)26(35)24(34)25(27(36)37)41-28(29)40-19-7-8-20-22(13-19)39-14-21(23(20)33)17-3-5-18(32)6-4-17/h3-8,13-14,16,24-26,28,30-32,34-35,38H,9-12,15H2,1-2H3,(H,36,37)/t16-,24+,25-,26-,28+,29-/m0/s1 |
| InChIKey | BRZMBXITVZQYNC-TXVBVSQOSA-N |
| XLogP | 1.03 |
| TPSA | 190.95 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.61 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|