C29H32N2O12 — CID 163066151
(2S,3R,4S,5R,6S)-6-[2-carbamoyl-3-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxy-4-formyl-3,4,5-trihydroxy-5-[(3-methylbutylamino)methyl]oxane-2-carboxylic acid (PubChem CID 163066151) has the molecular formula C29H32N2O12 and a molecular weight of 600.58 g/mol. Its IUPAC name is (2S,3R,4S,5R,6S)-6-[2-carbamoyl-3-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxy-4-formyl-3,4,5-trihydroxy-5-[(3-methylbutylamino)methyl]oxane-2-carboxylic acid.
| Compound Name | (2S,3R,4S,5R,6S)-6-[2-carbamoyl-3-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxy-4-formyl-3,4,5-trihydroxy-5-[(3-methylbutylamino)methyl]oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 163066151 |
| Molecular Formula | C29H32N2O12 |
| Molecular Weight | 600.58 g/mol |
| Exact Mass | 600.20 |
| IUPAC Name | (2S,3R,4S,5R,6S)-6-[2-carbamoyl-3-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxy-4-formyl-3,4,5-trihydroxy-5-[(3-methylbutylamino)methyl]oxane-2-carboxylic acid |
| SMILES | CC(C)CCNC[C@]1(O)[C@H](Oc2ccc3c(=O)c(-c4ccc(O)cc4)c(C(N)=O)oc3c2)O[C@H](C(=O)O)[C@@H](O)[C@@]1(O)C=O |
| InChI | InChI=1S/C29H32N2O12/c1-14(2)9-10-31-12-28(39)27(43-23(26(37)38)24(35)29(28,40)13-32)41-17-7-8-18-19(11-17)42-22(25(30)36)20(21(18)34)15-3-5-16(33)6-4-15/h3-8,11,13-14,23-24,27,31,33,35,39-40H,9-10,12H2,1-2H3,(H2,30,36)(H,37,38)/t23-,24+,27+,28-,29-/m0/s1 |
| InChIKey | WCPDOQNEEJRGAQ-UPUKVBQESA-N |
| XLogP | 0.11 |
| TPSA | 239.08 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.58 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|