C27H31NO10 — CID 163086179
3,4,5-trihydroxy-6-[3-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxy-5-[(3-methylbutylamino)methyl]oxane-2-carboxylic acid (PubChem CID 163086179) has the molecular formula C27H31NO10 and a molecular weight of 529.54 g/mol. Its IUPAC name is 3,4,5-trihydroxy-6-[3-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxy-5-[(3-methylbutylamino)methyl]oxane-2-carboxylic acid.
| Compound Name | 3,4,5-trihydroxy-6-[3-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxy-5-[(3-methylbutylamino)methyl]oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 163086179 |
| Molecular Formula | C27H31NO10 |
| Molecular Weight | 529.54 g/mol |
| Exact Mass | 529.19 |
| IUPAC Name | 3,4,5-trihydroxy-6-[3-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxy-5-[(3-methylbutylamino)methyl]oxane-2-carboxylic acid |
| SMILES | CC(C)CCNCC1(O)C(Oc2ccc3c(=O)c(-c4ccc(O)cc4)coc3c2)OC(C(=O)O)C(O)C1O |
| InChI | InChI=1S/C27H31NO10/c1-14(2)9-10-28-13-27(35)24(32)22(31)23(25(33)34)38-26(27)37-17-7-8-18-20(11-17)36-12-19(21(18)30)15-3-5-16(29)6-4-15/h3-8,11-12,14,22-24,26,28-29,31-32,35H,9-10,13H2,1-2H3,(H,33,34) |
| InChIKey | YLIRGWLGXXYHFJ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 178.92 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.54 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|