C15H20O4 — CID 162800848
1-[(1R,3S,4R,6R)-6-[(E)-pent-2-en-4-ynyl]-2,5-dioxabicyclo[2.2.1]heptan-3-yl]pent-4-ene-2,3-diol (PubChem CID 162800848) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is 1-[(1R,3S,4R,6R)-6-[(E)-pent-2-en-4-ynyl]-2,5-dioxabicyclo[2.2.1]heptan-3-yl]pent-4-ene-2,3-diol.
| Compound Name | 1-[(1R,3S,4R,6R)-6-[(E)-pent-2-en-4-ynyl]-2,5-dioxabicyclo[2.2.1]heptan-3-yl]pent-4-ene-2,3-diol |
|---|---|
| PubChem CID | 162800848 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 1-[(1R,3S,4R,6R)-6-[(E)-pent-2-en-4-ynyl]-2,5-dioxabicyclo[2.2.1]heptan-3-yl]pent-4-ene-2,3-diol |
| SMILES | C#C/C=C/C[C@H]1O[C@@H]2C[C@H]1O[C@H]2CC(O)C(O)C=C |
| InChI | InChI=1S/C15H20O4/c1-3-5-6-7-12-14-9-15(18-12)13(19-14)8-11(17)10(16)4-2/h1,4-6,10-17H,2,7-9H2/b6-5+/t10?,11?,12-,13+,14-,15-/m1/s1 |
| InChIKey | SUJOLGPDPVKMNS-INDSLRCGSA-N |
| XLogP | 0.79 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|