C15H17BrO2 — CID 162915988
(1S,2R,4E,5R)-4-(1-bromopropylidene)-2-[(Z)-pent-2-en-4-ynyl]-3,9-dioxabicyclo[3.3.1]non-6-ene (PubChem CID 162915988) has the molecular formula C15H17BrO2 and a molecular weight of 309.20 g/mol. Its IUPAC name is (1S,2R,4E,5R)-4-(1-bromopropylidene)-2-[(Z)-pent-2-en-4-ynyl]-3,9-dioxabicyclo[3.3.1]non-6-ene.
| Compound Name | (1S,2R,4E,5R)-4-(1-bromopropylidene)-2-[(Z)-pent-2-en-4-ynyl]-3,9-dioxabicyclo[3.3.1]non-6-ene |
|---|---|
| PubChem CID | 162915988 |
| Molecular Formula | C15H17BrO2 |
| Molecular Weight | 309.20 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | (1S,2R,4E,5R)-4-(1-bromopropylidene)-2-[(Z)-pent-2-en-4-ynyl]-3,9-dioxabicyclo[3.3.1]non-6-ene |
| SMILES | C#C/C=C\C[C@H]1O/C(=C(/Br)CC)[C@H]2C=CC[C@@H]1O2 |
| InChI | InChI=1S/C15H17BrO2/c1-3-5-6-8-13-12-9-7-10-14(17-12)15(18-13)11(16)4-2/h1,5-7,10,12-14H,4,8-9H2,2H3/b6-5-,15-11+/t12-,13+,14+/m0/s1 |
| InChIKey | MRJAVMATXWWNKM-KISKBFQLSA-N |
| XLogP | 3.69 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.20 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|