C15H22O4 — CID 163185772
(1R,3S,4R,6S,7R,9R)-3-ethyl-9-pent-2-en-4-ynyl-2,8-dioxabicyclo[5.2.1]decane-4,6-diol (PubChem CID 163185772) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is (1R,3S,4R,6S,7R,9R)-3-ethyl-9-pent-2-en-4-ynyl-2,8-dioxabicyclo[5.2.1]decane-4,6-diol.
| Compound Name | (1R,3S,4R,6S,7R,9R)-3-ethyl-9-pent-2-en-4-ynyl-2,8-dioxabicyclo[5.2.1]decane-4,6-diol |
|---|---|
| PubChem CID | 163185772 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | (1R,3S,4R,6S,7R,9R)-3-ethyl-9-pent-2-en-4-ynyl-2,8-dioxabicyclo[5.2.1]decane-4,6-diol |
| SMILES | C#CC=CC[C@H]1O[C@@H]2C[C@H]1O[C@@H](CC)[C@H](O)C[C@@H]2O |
| InChI | InChI=1S/C15H22O4/c1-3-5-6-7-13-15-9-14(19-13)11(17)8-10(16)12(4-2)18-15/h1,5-6,10-17H,4,7-9H2,2H3/t10-,11+,12+,13-,14-,15-/m1/s1 |
| InChIKey | UVRUJKKJLZZAJL-YXJLRHLOSA-N |
| XLogP | 1.01 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|