C20H28N4O3 — CID 162801491
2-[1-hexanoyl-3-(3H-imidazo[4,5-c]pyridin-2-ylmethyl)piperidin-4-yl]acetic acid (PubChem CID 162801491) has the molecular formula C20H28N4O3 and a molecular weight of 372.47 g/mol. Its IUPAC name is 2-[1-hexanoyl-3-(3H-imidazo[4,5-c]pyridin-2-ylmethyl)piperidin-4-yl]acetic acid.
| Compound Name | 2-[1-hexanoyl-3-(3H-imidazo[4,5-c]pyridin-2-ylmethyl)piperidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 162801491 |
| Molecular Formula | C20H28N4O3 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | 2-[1-hexanoyl-3-(3H-imidazo[4,5-c]pyridin-2-ylmethyl)piperidin-4-yl]acetic acid |
| SMILES | CCCCCC(=O)N1CCC(CC(=O)O)C(Cc2nc3ccncc3[nH]2)C1 |
| InChI | InChI=1S/C20H28N4O3/c1-2-3-4-5-19(25)24-9-7-14(11-20(26)27)15(13-24)10-18-22-16-6-8-21-12-17(16)23-18/h6,8,12,14-15H,2-5,7,9-11,13H2,1H3,(H,22,23)(H,26,27) |
| InChIKey | AZOYDRNSZTYOAJ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|