C22H31N3O3 — CID 125417991
2-[(3R,4S)-1-hexanoyl-3-[(6-methyl-1H-benzimidazol-2-yl)methyl]piperidin-4-yl]acetic acid (PubChem CID 125417991) has the molecular formula C22H31N3O3 and a molecular weight of 385.51 g/mol. Its IUPAC name is 2-[(3R,4S)-1-hexanoyl-3-[(6-methyl-1H-benzimidazol-2-yl)methyl]piperidin-4-yl]acetic acid.
| Compound Name | 2-[(3R,4S)-1-hexanoyl-3-[(6-methyl-1H-benzimidazol-2-yl)methyl]piperidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 125417991 |
| Molecular Formula | C22H31N3O3 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | 2-[(3R,4S)-1-hexanoyl-3-[(6-methyl-1H-benzimidazol-2-yl)methyl]piperidin-4-yl]acetic acid |
| SMILES | CCCCCC(=O)N1CCC(CC(=O)O)[C@@H](Cc2nc3ccc(C)cc3[nH]2)C1 |
| InChI | InChI=1S/C22H31N3O3/c1-3-4-5-6-21(26)25-10-9-16(13-22(27)28)17(14-25)12-20-23-18-8-7-15(2)11-19(18)24-20/h7-8,11,16-17H,3-6,9-10,12-14H2,1-2H3,(H,23,24)(H,27,28)/t16?,17-/m0/s1 |
| InChIKey | XWWZLKZSMJOQNZ-DJNXLDHESA-N |
| XLogP | 3.93 |
| TPSA | 86.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|