C22H31N3O4 — CID 163006073
2-[1-hexanoyl-3-[(6-methoxy-1H-benzimidazol-2-yl)methyl]piperidin-4-yl]acetic acid (PubChem CID 163006073) has the molecular formula C22H31N3O4 and a molecular weight of 401.51 g/mol. Its IUPAC name is 2-[1-hexanoyl-3-[(6-methoxy-1H-benzimidazol-2-yl)methyl]piperidin-4-yl]acetic acid.
| Compound Name | 2-[1-hexanoyl-3-[(6-methoxy-1H-benzimidazol-2-yl)methyl]piperidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 163006073 |
| Molecular Formula | C22H31N3O4 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.23 |
| IUPAC Name | 2-[1-hexanoyl-3-[(6-methoxy-1H-benzimidazol-2-yl)methyl]piperidin-4-yl]acetic acid |
| SMILES | CCCCCC(=O)N1CCC(CC(=O)O)C(Cc2nc3ccc(OC)cc3[nH]2)C1 |
| InChI | InChI=1S/C22H31N3O4/c1-3-4-5-6-21(26)25-10-9-15(12-22(27)28)16(14-25)11-20-23-18-8-7-17(29-2)13-19(18)24-20/h7-8,13,15-16H,3-6,9-12,14H2,1-2H3,(H,23,24)(H,27,28) |
| InChIKey | BIGKPZGVEQNRRK-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 95.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|