C24H34N2O4 — CID 75614651
2-[1-hexanoyl-3-[(6-methoxy-3,4-dihydroisoquinolin-1-yl)methyl]piperidin-4-yl]acetic acid (PubChem CID 75614651) has the molecular formula C24H34N2O4 and a molecular weight of 414.55 g/mol. Its IUPAC name is 2-[1-hexanoyl-3-[(6-methoxy-3,4-dihydroisoquinolin-1-yl)methyl]piperidin-4-yl]acetic acid.
| Compound Name | 2-[1-hexanoyl-3-[(6-methoxy-3,4-dihydroisoquinolin-1-yl)methyl]piperidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 75614651 |
| Molecular Formula | C24H34N2O4 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.25 |
| IUPAC Name | 2-[1-hexanoyl-3-[(6-methoxy-3,4-dihydroisoquinolin-1-yl)methyl]piperidin-4-yl]acetic acid |
| SMILES | CCCCCC(=O)N1CCC(CC(=O)O)C(CC2=NCCc3cc(OC)ccc32)C1 |
| InChI | InChI=1S/C24H34N2O4/c1-3-4-5-6-23(27)26-12-10-17(15-24(28)29)19(16-26)14-22-21-8-7-20(30-2)13-18(21)9-11-25-22/h7-8,13,17,19H,3-6,9-12,14-16H2,1-2H3,(H,28,29) |
| InChIKey | WZLRQXWQKKGPCT-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|