C19H22N2O5 — CID 56773968
2-[(3R,4S)-4-(carboxymethyl)-3-(3,4-dihydroisoquinolin-1-ylmethyl)piperidin-1-yl]-2-oxoacetic acid (PubChem CID 56773968) has the molecular formula C19H22N2O5 and a molecular weight of 358.39 g/mol. Its IUPAC name is 2-[(3R,4S)-4-(carboxymethyl)-3-(3,4-dihydroisoquinolin-1-ylmethyl)piperidin-1-yl]-2-oxoacetic acid.
| Compound Name | 2-[(3R,4S)-4-(carboxymethyl)-3-(3,4-dihydroisoquinolin-1-ylmethyl)piperidin-1-yl]-2-oxoacetic acid |
|---|---|
| PubChem CID | 56773968 |
| Molecular Formula | C19H22N2O5 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 2-[(3R,4S)-4-(carboxymethyl)-3-(3,4-dihydroisoquinolin-1-ylmethyl)piperidin-1-yl]-2-oxoacetic acid |
| SMILES | O=C(O)C[C@@H]1CCN(C(=O)C(=O)O)C[C@@H]1CC1=NCCc2ccccc21 |
| InChI | InChI=1S/C19H22N2O5/c22-17(23)10-13-6-8-21(18(24)19(25)26)11-14(13)9-16-15-4-2-1-3-12(15)5-7-20-16/h1-4,13-14H,5-11H2,(H,22,23)(H,25,26)/t13-,14-/m0/s1 |
| InChIKey | XRLIDBWEWNHQIG-KBPBESRZSA-N |
| XLogP | 1.45 |
| TPSA | 107.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|