C24H34N2O3 — CID 51136732
2-[(3R,4S)-1-hexanoyl-3-[(7-methyl-3,4-dihydroisoquinolin-1-yl)methyl]piperidin-4-yl]acetic acid (PubChem CID 51136732) has the molecular formula C24H34N2O3 and a molecular weight of 398.55 g/mol. Its IUPAC name is 2-[(3R,4S)-1-hexanoyl-3-[(7-methyl-3,4-dihydroisoquinolin-1-yl)methyl]piperidin-4-yl]acetic acid.
| Compound Name | 2-[(3R,4S)-1-hexanoyl-3-[(7-methyl-3,4-dihydroisoquinolin-1-yl)methyl]piperidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 51136732 |
| Molecular Formula | C24H34N2O3 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.26 |
| IUPAC Name | 2-[(3R,4S)-1-hexanoyl-3-[(7-methyl-3,4-dihydroisoquinolin-1-yl)methyl]piperidin-4-yl]acetic acid |
| SMILES | CCCCCC(=O)N1CCC(CC(=O)O)[C@@H](CC2=NCCc3ccc(C)cc32)C1 |
| InChI | InChI=1S/C24H34N2O3/c1-3-4-5-6-23(27)26-12-10-19(15-24(28)29)20(16-26)14-22-21-13-17(2)7-8-18(21)9-11-25-22/h7-8,13,19-20H,3-6,9-12,14-16H2,1-2H3,(H,28,29)/t19?,20-/m0/s1 |
| InChIKey | OVWPXXQCZBORLT-ANYOKISRSA-N |
| XLogP | 4.25 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|