C29H30O7 — CID 162802981
2-[3-benzyl-4-hydroxy-5-(2-methylpropyl)phenyl]-3,7-dihydroxy-5-(3-hydroxypropoxy)chromen-4-one (PubChem CID 162802981) has the molecular formula C29H30O7 and a molecular weight of 490.55 g/mol. Its IUPAC name is 2-[3-benzyl-4-hydroxy-5-(2-methylpropyl)phenyl]-3,7-dihydroxy-5-(3-hydroxypropoxy)chromen-4-one.
| Compound Name | 2-[3-benzyl-4-hydroxy-5-(2-methylpropyl)phenyl]-3,7-dihydroxy-5-(3-hydroxypropoxy)chromen-4-one |
|---|---|
| PubChem CID | 162802981 |
| Molecular Formula | C29H30O7 |
| Molecular Weight | 490.55 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | 2-[3-benzyl-4-hydroxy-5-(2-methylpropyl)phenyl]-3,7-dihydroxy-5-(3-hydroxypropoxy)chromen-4-one |
| SMILES | CC(C)Cc1cc(-c2oc3cc(O)cc(OCCCO)c3c(=O)c2O)cc(Cc2ccccc2)c1O |
| InChI | InChI=1S/C29H30O7/c1-17(2)11-19-13-21(14-20(26(19)32)12-18-7-4-3-5-8-18)29-28(34)27(33)25-23(35-10-6-9-30)15-22(31)16-24(25)36-29/h3-5,7-8,13-17,30-32,34H,6,9-12H2,1-2H3 |
| InChIKey | KUSOKOIXRLJTAW-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 120.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.55 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|