C19H26N4O5 — CID 162804191
(3S,4R,5R)-N-(4-amino-4-oxobutyl)-4,5-dihydroxy-3-[(4-methylphenyl)carbamoylamino]cyclohexene-1-carboxamide (PubChem CID 162804191) has the molecular formula C19H26N4O5 and a molecular weight of 390.44 g/mol. Its IUPAC name is (3S,4R,5R)-N-(4-amino-4-oxobutyl)-4,5-dihydroxy-3-[(4-methylphenyl)carbamoylamino]cyclohexene-1-carboxamide.
| Compound Name | (3S,4R,5R)-N-(4-amino-4-oxobutyl)-4,5-dihydroxy-3-[(4-methylphenyl)carbamoylamino]cyclohexene-1-carboxamide |
|---|---|
| PubChem CID | 162804191 |
| Molecular Formula | C19H26N4O5 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | (3S,4R,5R)-N-(4-amino-4-oxobutyl)-4,5-dihydroxy-3-[(4-methylphenyl)carbamoylamino]cyclohexene-1-carboxamide |
| SMILES | Cc1ccc(NC(=O)N[C@H]2C=C(C(=O)NCCCC(N)=O)C[C@@H](O)[C@@H]2O)cc1 |
| InChI | InChI=1S/C19H26N4O5/c1-11-4-6-13(7-5-11)22-19(28)23-14-9-12(10-15(24)17(14)26)18(27)21-8-2-3-16(20)25/h4-7,9,14-15,17,24,26H,2-3,8,10H2,1H3,(H2,20,25)(H,21,27)(H2,22,23,28)/t14-,15+,17+/m0/s1 |
| InChIKey | ULDXLWPLQZOBNW-ZMSDIMECSA-N |
| XLogP | -0.08 |
| TPSA | 153.78 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|