C23H23ClN4O3 — CID 162809614
ethyl (6S,10S)-5-(4-chlorophenyl)-12-methyl-11-oxo-2,4,5,12-tetrazatetracyclo[11.4.0.02,6.06,10]heptadeca-1(17),3,13,15-tetraene-3-carboxylate (PubChem CID 162809614) has the molecular formula C23H23ClN4O3 and a molecular weight of 438.92 g/mol. Its IUPAC name is ethyl (6S,10S)-5-(4-chlorophenyl)-12-methyl-11-oxo-2,4,5,12-tetrazatetracyclo[11.4.0.02,6.06,10]heptadeca-1(17),3,13,15-tetraene-3-carboxylate.
| Compound Name | ethyl (6S,10S)-5-(4-chlorophenyl)-12-methyl-11-oxo-2,4,5,12-tetrazatetracyclo[11.4.0.02,6.06,10]heptadeca-1(17),3,13,15-tetraene-3-carboxylate |
|---|---|
| PubChem CID | 162809614 |
| Molecular Formula | C23H23ClN4O3 |
| Molecular Weight | 438.92 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | ethyl (6S,10S)-5-(4-chlorophenyl)-12-methyl-11-oxo-2,4,5,12-tetrazatetracyclo[11.4.0.02,6.06,10]heptadeca-1(17),3,13,15-tetraene-3-carboxylate |
| SMILES | CCOC(=O)C1=NN(c2ccc(Cl)cc2)[C@@]23CCC[C@@H]2C(=O)N(C)c2ccccc2N13 |
| InChI | InChI=1S/C23H23ClN4O3/c1-3-31-22(30)20-25-28(16-12-10-15(24)11-13-16)23-14-6-7-17(23)21(29)26(2)18-8-4-5-9-19(18)27(20)23/h4-5,8-13,17H,3,6-7,14H2,1-2H3/t17-,23+/m1/s1 |
| InChIKey | YFOLEAXPQVQHGH-HXOBKFHXSA-N |
| XLogP | 4.02 |
| TPSA | 65.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.92 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |