C18H22N2O3 — CID 162811030
(3R,8S,9aS)-3-benzyl-8-prop-2-enoxy-3,6,7,8,9,9a-hexahydro-2H-pyrido[1,2-a]pyrazine-1,4-dione (PubChem CID 162811030) has the molecular formula C18H22N2O3 and a molecular weight of 314.38 g/mol. Its IUPAC name is (3R,8S,9aS)-3-benzyl-8-prop-2-enoxy-3,6,7,8,9,9a-hexahydro-2H-pyrido[1,2-a]pyrazine-1,4-dione.
| Compound Name | (3R,8S,9aS)-3-benzyl-8-prop-2-enoxy-3,6,7,8,9,9a-hexahydro-2H-pyrido[1,2-a]pyrazine-1,4-dione |
|---|---|
| PubChem CID | 162811030 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | (3R,8S,9aS)-3-benzyl-8-prop-2-enoxy-3,6,7,8,9,9a-hexahydro-2H-pyrido[1,2-a]pyrazine-1,4-dione |
| SMILES | C=CCO[C@H]1CCN2C(=O)[C@@H](Cc3ccccc3)NC(=O)[C@@H]2C1 |
| InChI | InChI=1S/C18H22N2O3/c1-2-10-23-14-8-9-20-16(12-14)17(21)19-15(18(20)22)11-13-6-4-3-5-7-13/h2-7,14-16H,1,8-12H2,(H,19,21)/t14-,15+,16-/m0/s1 |
| InChIKey | YDQOOGCTBMLUEA-XHSDSOJGSA-N |
| XLogP | 1.29 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|