C30H22O12 — CID 162812309
(3R,4R)-3-[(3S,4R)-5,7-dihydroxy-4-(4-hydroxyphenyl)-2-oxo-3,4-dihydrochromen-3-yl]-5,6,7,8-tetrahydroxy-4-(4-hydroxyphenyl)-3,4-dihydrochromen-2-one (PubChem CID 162812309) has the molecular formula C30H22O12 and a molecular weight of 574.49 g/mol. Its IUPAC name is (3R,4R)-3-[(3S,4R)-5,7-dihydroxy-4-(4-hydroxyphenyl)-2-oxo-3,4-dihydrochromen-3-yl]-5,6,7,8-tetrahydroxy-4-(4-hydroxyphenyl)-3,4-dihydrochromen-2-one.
| Compound Name | (3R,4R)-3-[(3S,4R)-5,7-dihydroxy-4-(4-hydroxyphenyl)-2-oxo-3,4-dihydrochromen-3-yl]-5,6,7,8-tetrahydroxy-4-(4-hydroxyphenyl)-3,4-dihydrochromen-2-one |
|---|---|
| PubChem CID | 162812309 |
| Molecular Formula | C30H22O12 |
| Molecular Weight | 574.49 g/mol |
| Exact Mass | 574.11 |
| IUPAC Name | (3R,4R)-3-[(3S,4R)-5,7-dihydroxy-4-(4-hydroxyphenyl)-2-oxo-3,4-dihydrochromen-3-yl]-5,6,7,8-tetrahydroxy-4-(4-hydroxyphenyl)-3,4-dihydrochromen-2-one |
| SMILES | O=C1Oc2c(O)c(O)c(O)c(O)c2[C@@H](c2ccc(O)cc2)[C@@H]1[C@H]1C(=O)Oc2cc(O)cc(O)c2[C@H]1c1ccc(O)cc1 |
| InChI | InChI=1S/C30H22O12/c31-13-5-1-11(2-6-13)18-20-16(34)9-15(33)10-17(20)41-29(39)21(18)22-19(12-3-7-14(32)8-4-12)23-24(35)25(36)26(37)27(38)28(23)42-30(22)40/h1-10,18-19,21-22,31-38H/t18-,19+,21+,22-/m1/s1 |
| InChIKey | QYSIAYFWYFMESL-XMGTWHOFSA-N |
| XLogP | 3.37 |
| TPSA | 214.44 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.49 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|