C29H42O12 — CID 162812797
[3,4,5-triacetyloxy-6-[4-(4-acetyloxy-2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-2-yloxy]oxan-2-yl]methyl acetate (PubChem CID 162812797) has the molecular formula C29H42O12 and a molecular weight of 582.64 g/mol. Its IUPAC name is [3,4,5-triacetyloxy-6-[4-(4-acetyloxy-2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-2-yloxy]oxan-2-yl]methyl acetate.
| Compound Name | [3,4,5-triacetyloxy-6-[4-(4-acetyloxy-2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-2-yloxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 162812797 |
| Molecular Formula | C29H42O12 |
| Molecular Weight | 582.64 g/mol |
| Exact Mass | 582.27 |
| IUPAC Name | [3,4,5-triacetyloxy-6-[4-(4-acetyloxy-2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-2-yloxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(OC(C)C=CC2C(C)=CC(OC(C)=O)CC2(C)C)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C29H42O12/c1-15-12-22(37-18(4)31)13-29(8,9)23(15)11-10-16(2)36-28-27(40-21(7)34)26(39-20(6)33)25(38-19(5)32)24(41-28)14-35-17(3)30/h10-12,16,22-28H,13-14H2,1-9H3 |
| InChIKey | JPQMILWUUDTYNB-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 149.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.64 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|