C27H38O12 — CID 163072199
[(2R,3R,4S,5R,6R)-6-[(1S)-1-[(2R,7aS)-4,4,7a-trimethyl-6-oxo-5,7-dihydro-2H-1-benzofuran-2-yl]ethoxy]-3,4,5-triacetyloxyoxan-2-yl]methyl acetate (PubChem CID 163072199) has the molecular formula C27H38O12 and a molecular weight of 554.59 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-6-[(1S)-1-[(2R,7aS)-4,4,7a-trimethyl-6-oxo-5,7-dihydro-2H-1-benzofuran-2-yl]ethoxy]-3,4,5-triacetyloxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-6-[(1S)-1-[(2R,7aS)-4,4,7a-trimethyl-6-oxo-5,7-dihydro-2H-1-benzofuran-2-yl]ethoxy]-3,4,5-triacetyloxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 163072199 |
| Molecular Formula | C27H38O12 |
| Molecular Weight | 554.59 g/mol |
| Exact Mass | 554.24 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-6-[(1S)-1-[(2R,7aS)-4,4,7a-trimethyl-6-oxo-5,7-dihydro-2H-1-benzofuran-2-yl]ethoxy]-3,4,5-triacetyloxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](O[C@@H](C)[C@H]2C=C3C(C)(C)CC(=O)C[C@]3(C)O2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C27H38O12/c1-13(19-9-21-26(6,7)10-18(32)11-27(21,8)39-19)34-25-24(37-17(5)31)23(36-16(4)30)22(35-15(3)29)20(38-25)12-33-14(2)28/h9,13,19-20,22-25H,10-12H2,1-8H3/t13-,19+,20+,22+,23-,24+,25+,27-/m0/s1 |
| InChIKey | PCNGQBDDAAPZBS-XCXARXHZSA-N |
| XLogP | 1.95 |
| TPSA | 149.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.59 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|