C29H42O13 — CID 162945599
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[(2R)-4-[(2R,4S)-4-acetyloxy-2-hydroxy-2,6,6-trimethylcyclohexylidene]but-3-en-2-yl]oxyoxan-2-yl]methyl acetate (PubChem CID 162945599) has the molecular formula C29H42O13 and a molecular weight of 598.64 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[(2R)-4-[(2R,4S)-4-acetyloxy-2-hydroxy-2,6,6-trimethylcyclohexylidene]but-3-en-2-yl]oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[(2R)-4-[(2R,4S)-4-acetyloxy-2-hydroxy-2,6,6-trimethylcyclohexylidene]but-3-en-2-yl]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 162945599 |
| Molecular Formula | C29H42O13 |
| Molecular Weight | 598.64 g/mol |
| Exact Mass | 598.26 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[(2R)-4-[(2R,4S)-4-acetyloxy-2-hydroxy-2,6,6-trimethylcyclohexylidene]but-3-en-2-yl]oxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](O[C@H](C)C=C=C2C(C)(C)C[C@H](OC(C)=O)C[C@@]2(C)O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C29H42O13/c1-15(10-11-23-28(7,8)12-21(38-17(3)31)13-29(23,9)35)37-27-26(41-20(6)34)25(40-19(5)33)24(39-18(4)32)22(42-27)14-36-16(2)30/h10,15,21-22,24-27,35H,12-14H2,1-9H3/t11?,15-,21+,22-,24-,25+,26-,27-,29-/m1/s1 |
| InChIKey | DXYHLCCAMUBPHD-ZVIPFSBKSA-N |
| XLogP | 2.06 |
| TPSA | 170.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.64 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|