C27H42O11 — CID 73113805
[3,4,5-triacetyloxy-6-[4-(2,2,6-trimethyl-4-oxocyclohexyl)butan-2-yloxy]oxan-2-yl]methyl acetate (PubChem CID 73113805) has the molecular formula C27H42O11 and a molecular weight of 542.62 g/mol. Its IUPAC name is [3,4,5-triacetyloxy-6-[4-(2,2,6-trimethyl-4-oxocyclohexyl)butan-2-yloxy]oxan-2-yl]methyl acetate.
| Compound Name | [3,4,5-triacetyloxy-6-[4-(2,2,6-trimethyl-4-oxocyclohexyl)butan-2-yloxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 73113805 |
| Molecular Formula | C27H42O11 |
| Molecular Weight | 542.62 g/mol |
| Exact Mass | 542.27 |
| IUPAC Name | [3,4,5-triacetyloxy-6-[4-(2,2,6-trimethyl-4-oxocyclohexyl)butan-2-yloxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(OC(C)CCC2C(C)CC(=O)CC2(C)C)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C27H42O11/c1-14-11-20(32)12-27(7,8)21(14)10-9-15(2)34-26-25(37-19(6)31)24(36-18(5)30)23(35-17(4)29)22(38-26)13-33-16(3)28/h14-15,21-26H,9-13H2,1-8H3 |
| InChIKey | RSSIXGVMWOITFJ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.62 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|