C25H36O5 — CID 162813781
2-hydroxy-2,4,4-tris(3-methylbut-2-enyl)-6-(2-methylpropanoyl)cyclohexane-1,3,5-trione (PubChem CID 162813781) has the molecular formula C25H36O5 and a molecular weight of 416.56 g/mol. Its IUPAC name is 2-hydroxy-2,4,4-tris(3-methylbut-2-enyl)-6-(2-methylpropanoyl)cyclohexane-1,3,5-trione.
| Compound Name | 2-hydroxy-2,4,4-tris(3-methylbut-2-enyl)-6-(2-methylpropanoyl)cyclohexane-1,3,5-trione |
|---|---|
| PubChem CID | 162813781 |
| Molecular Formula | C25H36O5 |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 416.26 |
| IUPAC Name | 2-hydroxy-2,4,4-tris(3-methylbut-2-enyl)-6-(2-methylpropanoyl)cyclohexane-1,3,5-trione |
| SMILES | CC(C)=CCC1(O)C(=O)C(C(=O)C(C)C)C(=O)C(CC=C(C)C)(CC=C(C)C)C1=O |
| InChI | InChI=1S/C25H36O5/c1-15(2)9-12-24(13-10-16(3)4)21(27)19(20(26)18(7)8)22(28)25(30,23(24)29)14-11-17(5)6/h9-11,18-19,30H,12-14H2,1-8H3 |
| InChIKey | SLIXMIXEBCIOLT-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|